ehthaboe4074 ehthaboe4074

01-04-2022
Mathematics

contestada

A 10 inch candle burns at a rate of 1.2 inches an hour. How many hours mess the candle burn until it is less than 1 inch tall

Respuesta :

raeiw23 raeiw23

01-04-2022

8 hours
1 x 8 = 8
.2 x 10 = .20
.10 = 1
.20 - .10 or 1 = 1
1+1 = 2
2+ 8 = 10 hours

Answer Link

Otras preguntas

What’s the answer to 13x+7= 8x+27 ?

How are reactants converted to products in an elementary reaction?

If X is five then 6X equals what

What is the authors purpose in the poem cant

Which of the statements below is not a correct part of collision theory? a. Reactant molecules must have some minimum amount of energy to react. b. Every time

1. 40 lb is what percent of 75 lb?

Describe the transformation from f(x)=x for m(x)=(x-5) Question 1 options: Down 5 units Up 5 units To the right 5 units To the left 5 units

For her vacation Mrs. Andrews bought $300 worth of traveler's checks in $10 and $20 denominations travelers checks in all, how many of each denomination does sh

cosec(6b+pi/8)=sec(2b-pi/8)

how many square yards are in 156 square ft