Master4life503 Master4life503
  • 04-11-2016
  • Mathematics
contestada

(10 + n) (1)= 10 + n
Help

Respuesta :

OwOWhatsThisOwO
OwOWhatsThisOwO OwOWhatsThisOwO
  • 04-11-2016
(1)(10+n)=10+n
You just distribute the 1 to 10+n and you get the answer
Answer Link

Otras preguntas

If the power dissipated in a battery is 24W with a current of 2A. Calculate the voltage of the battery. ​
Holiday Laboratories purchased a high-speed industrial centrifuge at a cost of $460,000. Shipping costs totaled $11,000. Foundation work to house the centrifuge
Ritual is a fundamental aspect of culture. Write one paragraph
Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl
Describe and compare imperative (C), functional (SML) and logic (Prolog) programming paradigms.
Which is a positively charged particle in an atom’s nucleus?
In the figure below, if the angle is right what is the value of x?​
Define attitude and prejudice, and describe the three basic components of an attitude, using them to differentiate between a stereotype and discrimination.
Two similar figures have sides in the ratio of 2:3. Ita side of the smaller triangle has a length of 7, what is the length of the corresponding side of the othe
Which graph represents a function?